C19H21F3N6O — CID 142988285
N-cyano-5-(4-methylphenyl)-4-(2-oxopyrrolidin-1-yl)-N'-(3,3,3-trifluoropropyl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142988285) has the molecular formula C19H21F3N6O and a molecular weight of 406.41 g/mol. Its IUPAC name is N-cyano-5-(4-methylphenyl)-4-(2-oxopyrrolidin-1-yl)-N'-(3,3,3-trifluoropropyl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N-cyano-5-(4-methylphenyl)-4-(2-oxopyrrolidin-1-yl)-N'-(3,3,3-trifluoropropyl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142988285 |
| Molecular Formula | C19H21F3N6O |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-cyano-5-(4-methylphenyl)-4-(2-oxopyrrolidin-1-yl)-N'-(3,3,3-trifluoropropyl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | Cc1ccc(C2=NN(/C(=N/CCC(F)(F)F)NC#N)CC2N2CCCC2=O)cc1 |
| InChI | InChI=1S/C19H21F3N6O/c1-13-4-6-14(7-5-13)17-15(27-10-2-3-16(27)29)11-28(26-17)18(25-12-23)24-9-8-19(20,21)22/h4-7,15H,2-3,8-11H2,1H3,(H,24,25) |
| InChIKey | YPPMVZSCFJIZLL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|