C25H29FN6O — CID 142988290
N-cyano-5-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]-4-(2-oxopiperidin-1-yl)-N'-(2-phenylethyl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142988290) has the molecular formula C25H29FN6O and a molecular weight of 448.55 g/mol. Its IUPAC name is N-cyano-5-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]-4-(2-oxopiperidin-1-yl)-N'-(2-phenylethyl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N-cyano-5-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]-4-(2-oxopiperidin-1-yl)-N'-(2-phenylethyl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142988290 |
| Molecular Formula | C25H29FN6O |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | N-cyano-5-[(2E,4Z)-6-fluorohepta-2,4,6-trien-3-yl]-4-(2-oxopiperidin-1-yl)-N'-(2-phenylethyl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | C=C(F)/C=C\C(=C/C)C1=NN(/C(=N/CCc2ccccc2)NC#N)CC1N1CCCCC1=O |
| InChI | InChI=1S/C25H29FN6O/c1-3-21(13-12-19(2)26)24-22(31-16-8-7-11-23(31)33)17-32(30-24)25(29-18-27)28-15-14-20-9-5-4-6-10-20/h3-6,9-10,12-13,22H,2,7-8,11,14-17H2,1H3,(H,28,29)/b13-12-,21-3+ |
| InChIKey | MPPITNMDSOFPBK-IYVJERKVSA-N |
| XLogP | 3.69 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|