C19H18F6N6OS — CID 142988385
N-cyano-4-(2-oxopyrrolidin-1-yl)-5-[4-(trifluoromethyl)phenyl]-N'-[2-(trifluoromethylsulfanyl)ethyl]-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142988385) has the molecular formula C19H18F6N6OS and a molecular weight of 492.45 g/mol. Its IUPAC name is N-cyano-4-(2-oxopyrrolidin-1-yl)-5-[4-(trifluoromethyl)phenyl]-N'-[2-(trifluoromethylsulfanyl)ethyl]-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N-cyano-4-(2-oxopyrrolidin-1-yl)-5-[4-(trifluoromethyl)phenyl]-N'-[2-(trifluoromethylsulfanyl)ethyl]-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142988385 |
| Molecular Formula | C19H18F6N6OS |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | N-cyano-4-(2-oxopyrrolidin-1-yl)-5-[4-(trifluoromethyl)phenyl]-N'-[2-(trifluoromethylsulfanyl)ethyl]-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | N#CN/C(=N\CCSC(F)(F)F)N1CC(N2CCCC2=O)C(c2ccc(C(F)(F)F)cc2)=N1 |
| InChI | InChI=1S/C19H18F6N6OS/c20-18(21,22)13-5-3-12(4-6-13)16-14(30-8-1-2-15(30)32)10-31(29-16)17(28-11-26)27-7-9-33-19(23,24)25/h3-6,14H,1-2,7-10H2,(H,27,28) |
| InChIKey | BQLJMTSBEMLCIE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|