C22H26F3N7O2 — CID 162580557
1-cyano-2-[3-imino-2-(2-oxopyrrolidin-1-yl)-3-[4-(trifluoromethyl)phenyl]propyl]-3-[2-(2-oxopyrrolidin-1-yl)ethyl]guanidine (PubChem CID 162580557) has the molecular formula C22H26F3N7O2 and a molecular weight of 477.49 g/mol. Its IUPAC name is 1-cyano-2-[3-imino-2-(2-oxopyrrolidin-1-yl)-3-[4-(trifluoromethyl)phenyl]propyl]-3-[2-(2-oxopyrrolidin-1-yl)ethyl]guanidine.
| Compound Name | 1-cyano-2-[3-imino-2-(2-oxopyrrolidin-1-yl)-3-[4-(trifluoromethyl)phenyl]propyl]-3-[2-(2-oxopyrrolidin-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 162580557 |
| Molecular Formula | C22H26F3N7O2 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 1-cyano-2-[3-imino-2-(2-oxopyrrolidin-1-yl)-3-[4-(trifluoromethyl)phenyl]propyl]-3-[2-(2-oxopyrrolidin-1-yl)ethyl]guanidine |
| SMILES | [H]/N=C(\c1ccc(C(F)(F)F)cc1)C(C/N=C(\NC#N)NCCN1CCCC1=O)N1CCCC1=O |
| InChI | InChI=1S/C22H26F3N7O2/c23-22(24,25)16-7-5-15(6-8-16)20(27)17(32-11-2-4-19(32)34)13-29-21(30-14-26)28-9-12-31-10-1-3-18(31)33/h5-8,17,27H,1-4,9-13H2,(H2,28,29,30)/b27-20+ |
| InChIKey | AYACOQKQEJYTTM-NHFJDJAPSA-N |
| XLogP | 1.70 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|