C24H24F4N6O — CID 162580555
1-cyano-3-[2-(2-fluorophenyl)ethyl]-2-[3-imino-2-(2-oxopyrrolidin-1-yl)-3-[4-(trifluoromethyl)phenyl]propyl]guanidine (PubChem CID 162580555) has the molecular formula C24H24F4N6O and a molecular weight of 488.49 g/mol. Its IUPAC name is 1-cyano-3-[2-(2-fluorophenyl)ethyl]-2-[3-imino-2-(2-oxopyrrolidin-1-yl)-3-[4-(trifluoromethyl)phenyl]propyl]guanidine.
| Compound Name | 1-cyano-3-[2-(2-fluorophenyl)ethyl]-2-[3-imino-2-(2-oxopyrrolidin-1-yl)-3-[4-(trifluoromethyl)phenyl]propyl]guanidine |
|---|---|
| PubChem CID | 162580555 |
| Molecular Formula | C24H24F4N6O |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 1-cyano-3-[2-(2-fluorophenyl)ethyl]-2-[3-imino-2-(2-oxopyrrolidin-1-yl)-3-[4-(trifluoromethyl)phenyl]propyl]guanidine |
| SMILES | [H]/N=C(\c1ccc(C(F)(F)F)cc1)C(C/N=C(\NC#N)NCCc1ccccc1F)N1CCCC1=O |
| InChI | InChI=1S/C24H24F4N6O/c25-19-5-2-1-4-16(19)11-12-31-23(33-15-29)32-14-20(34-13-3-6-21(34)35)22(30)17-7-9-18(10-8-17)24(26,27)28/h1-2,4-5,7-10,20,30H,3,6,11-14H2,(H2,31,32,33)/b30-22+ |
| InChIKey | SRWILFKQISTLSX-JBASAIQMSA-N |
| XLogP | 3.46 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|