C24H25ClF3N6O+ — CID 142988440
[3-[[[2-(2-chlorophenyl)ethylamino]-(cyanoamino)methylidene]amino]-2-(2-oxopyrrolidin-1-yl)-1-[4-(trifluoromethyl)phenyl]propylidene]azanium (PubChem CID 142988440) has the molecular formula C24H25ClF3N6O+ and a molecular weight of 505.95 g/mol. Its IUPAC name is [3-[[[2-(2-chlorophenyl)ethylamino]-(cyanoamino)methylidene]amino]-2-(2-oxopyrrolidin-1-yl)-1-[4-(trifluoromethyl)phenyl]propylidene]azanium.
| Compound Name | [3-[[[2-(2-chlorophenyl)ethylamino]-(cyanoamino)methylidene]amino]-2-(2-oxopyrrolidin-1-yl)-1-[4-(trifluoromethyl)phenyl]propylidene]azanium |
|---|---|
| PubChem CID | 142988440 |
| Molecular Formula | C24H25ClF3N6O+ |
| Molecular Weight | 505.95 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | [3-[[[2-(2-chlorophenyl)ethylamino]-(cyanoamino)methylidene]amino]-2-(2-oxopyrrolidin-1-yl)-1-[4-(trifluoromethyl)phenyl]propylidene]azanium |
| SMILES | N#CN/C(=N\CC(C(=[NH2+])c1ccc(C(F)(F)F)cc1)N1CCCC1=O)NCCc1ccccc1Cl |
| InChI | InChI=1S/C24H24ClF3N6O/c25-19-5-2-1-4-16(19)11-12-31-23(33-15-29)32-14-20(34-13-3-6-21(34)35)22(30)17-7-9-18(10-8-17)24(26,27)28/h1-2,4-5,7-10,20,30H,3,6,11-14H2,(H2,31,32,33)/p+1 |
| InChIKey | ZFXGDBMUPNAVSV-UHFFFAOYSA-O |
| XLogP | 2.16 |
| TPSA | 106.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.95 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|