C24H27F3N6O2 — CID 162580553
1-cyano-3-[2-(4-hydroxycyclohexa-1,5-dien-1-yl)ethyl]-2-[3-imino-2-(2-oxopyrrolidin-1-yl)-3-[4-(trifluoromethyl)phenyl]propyl]guanidine (PubChem CID 162580553) has the molecular formula C24H27F3N6O2 and a molecular weight of 488.51 g/mol. Its IUPAC name is 1-cyano-3-[2-(4-hydroxycyclohexa-1,5-dien-1-yl)ethyl]-2-[3-imino-2-(2-oxopyrrolidin-1-yl)-3-[4-(trifluoromethyl)phenyl]propyl]guanidine.
| Compound Name | 1-cyano-3-[2-(4-hydroxycyclohexa-1,5-dien-1-yl)ethyl]-2-[3-imino-2-(2-oxopyrrolidin-1-yl)-3-[4-(trifluoromethyl)phenyl]propyl]guanidine |
|---|---|
| PubChem CID | 162580553 |
| Molecular Formula | C24H27F3N6O2 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 1-cyano-3-[2-(4-hydroxycyclohexa-1,5-dien-1-yl)ethyl]-2-[3-imino-2-(2-oxopyrrolidin-1-yl)-3-[4-(trifluoromethyl)phenyl]propyl]guanidine |
| SMILES | [H]/N=C(\c1ccc(C(F)(F)F)cc1)C(C/N=C(\NC#N)NCCC1=CCC(O)C=C1)N1CCCC1=O |
| InChI | InChI=1S/C24H27F3N6O2/c25-24(26,27)18-7-5-17(6-8-18)22(29)20(33-13-1-2-21(33)35)14-31-23(32-15-28)30-12-11-16-3-9-19(34)10-4-16/h3-9,19-20,29,34H,1-2,10-14H2,(H2,30,31,32)/b29-22+ |
| InChIKey | YCISQWSRJRXJBW-QUPMIFSKSA-N |
| XLogP | 2.72 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|