C20H23ClN4O — CID 67613976
4-[[amino(pyrrolidin-1-yl)methylidene]amino]-N-[2-(2-chlorophenyl)ethyl]benzamide (PubChem CID 67613976) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is 4-[[amino(pyrrolidin-1-yl)methylidene]amino]-N-[2-(2-chlorophenyl)ethyl]benzamide.
| Compound Name | 4-[[amino(pyrrolidin-1-yl)methylidene]amino]-N-[2-(2-chlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 67613976 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 4-[[amino(pyrrolidin-1-yl)methylidene]amino]-N-[2-(2-chlorophenyl)ethyl]benzamide |
| SMILES | N/C(=N\c1ccc(C(=O)NCCc2ccccc2Cl)cc1)N1CCCC1 |
| InChI | InChI=1S/C20H23ClN4O/c21-18-6-2-1-5-15(18)11-12-23-19(26)16-7-9-17(10-8-16)24-20(22)25-13-3-4-14-25/h1-2,5-10H,3-4,11-14H2,(H2,22,24)(H,23,26) |
| InChIKey | KHGQFTDEMCFLKB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|