C17H23ClN2O2S — CID 99946891
(2S)-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-2-(2-oxopyrrolidin-1-yl)propanamide (PubChem CID 99946891) has the molecular formula C17H23ClN2O2S and a molecular weight of 354.90 g/mol. Its IUPAC name is (2S)-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-2-(2-oxopyrrolidin-1-yl)propanamide.
| Compound Name | (2S)-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-2-(2-oxopyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 99946891 |
| Molecular Formula | C17H23ClN2O2S |
| Molecular Weight | 354.90 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (2S)-N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-2-(2-oxopyrrolidin-1-yl)propanamide |
| SMILES | C[C@@H](C(=O)NCCCSCc1ccccc1Cl)N1CCCC1=O |
| InChI | InChI=1S/C17H23ClN2O2S/c1-13(20-10-4-8-16(20)21)17(22)19-9-5-11-23-12-14-6-2-3-7-15(14)18/h2-3,6-7,13H,4-5,8-12H2,1H3,(H,19,22)/t13-/m0/s1 |
| InChIKey | NZDZONPDYUICNW-ZDUSSCGKSA-N |
| XLogP | 3.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.90 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|