C18H28ClN3OS — CID 74241500
N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-2-(1,4-dimethylpiperazin-2-yl)acetamide (PubChem CID 74241500) has the molecular formula C18H28ClN3OS and a molecular weight of 369.96 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-2-(1,4-dimethylpiperazin-2-yl)acetamide.
| Compound Name | N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-2-(1,4-dimethylpiperazin-2-yl)acetamide |
|---|---|
| PubChem CID | 74241500 |
| Molecular Formula | C18H28ClN3OS |
| Molecular Weight | 369.96 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-2-(1,4-dimethylpiperazin-2-yl)acetamide |
| SMILES | CN1CCN(C)C(CC(=O)NCCCSCc2ccccc2Cl)C1 |
| InChI | InChI=1S/C18H28ClN3OS/c1-21-9-10-22(2)16(13-21)12-18(23)20-8-5-11-24-14-15-6-3-4-7-17(15)19/h3-4,6-7,16H,5,8-14H2,1-2H3,(H,20,23) |
| InChIKey | XZBSVYLIWLOWDF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.96 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|