C14H18ClN5OS — CID 74247222
1-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-3-(1-methyltriazol-4-yl)urea (PubChem CID 74247222) has the molecular formula C14H18ClN5OS and a molecular weight of 339.85 g/mol. Its IUPAC name is 1-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-3-(1-methyltriazol-4-yl)urea.
| Compound Name | 1-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-3-(1-methyltriazol-4-yl)urea |
|---|---|
| PubChem CID | 74247222 |
| Molecular Formula | C14H18ClN5OS |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-[3-[(2-chlorophenyl)methylsulfanyl]propyl]-3-(1-methyltriazol-4-yl)urea |
| SMILES | Cn1cc(NC(=O)NCCCSCc2ccccc2Cl)nn1 |
| InChI | InChI=1S/C14H18ClN5OS/c1-20-9-13(18-19-20)17-14(21)16-7-4-8-22-10-11-5-2-3-6-12(11)15/h2-3,5-6,9H,4,7-8,10H2,1H3,(H2,16,17,21) |
| InChIKey | PVNYYSHZHDALBM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|