C22H23F3N2O3 — CID 56505315
2-(2-oxopiperidin-1-yl)-2-phenyl-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]acetamide (PubChem CID 56505315) has the molecular formula C22H23F3N2O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is 2-(2-oxopiperidin-1-yl)-2-phenyl-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]acetamide.
| Compound Name | 2-(2-oxopiperidin-1-yl)-2-phenyl-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 56505315 |
| Molecular Formula | C22H23F3N2O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-(2-oxopiperidin-1-yl)-2-phenyl-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]acetamide |
| SMILES | O=C(NCCOc1ccc(C(F)(F)F)cc1)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C22H23F3N2O3/c23-22(24,25)17-9-11-18(12-10-17)30-15-13-26-21(29)20(16-6-2-1-3-7-16)27-14-5-4-8-19(27)28/h1-3,6-7,9-12,20H,4-5,8,13-15H2,(H,26,29) |
| InChIKey | GFNLGFIDYSPCMR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|