C23H46N2O4 — CID 142989229
ethane;ethyl 6-(3,3-dimethylpentanoylamino)-2-(2-methylprop-2-enoylamino)hexanoate (PubChem CID 142989229) has the molecular formula C23H46N2O4 and a molecular weight of 414.63 g/mol. Its IUPAC name is ethane;ethyl 6-(3,3-dimethylpentanoylamino)-2-(2-methylprop-2-enoylamino)hexanoate.
| Compound Name | ethane;ethyl 6-(3,3-dimethylpentanoylamino)-2-(2-methylprop-2-enoylamino)hexanoate |
|---|---|
| PubChem CID | 142989229 |
| Molecular Formula | C23H46N2O4 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.35 |
| IUPAC Name | ethane;ethyl 6-(3,3-dimethylpentanoylamino)-2-(2-methylprop-2-enoylamino)hexanoate |
| SMILES | C=C(C)C(=O)NC(CCCCNC(=O)CC(C)(C)CC)C(=O)OCC.CC.CC |
| InChI | InChI=1S/C19H34N2O4.2C2H6/c1-7-19(5,6)13-16(22)20-12-10-9-11-15(18(24)25-8-2)21-17(23)14(3)4;2*1-2/h15H,3,7-13H2,1-2,4-6H3,(H,20,22)(H,21,23);2*1-2H3 |
| InChIKey | IGWMYQFMPMRPDQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|