C30H67N — CID 142990160
N,7-dimethyl-N-[(2S)-2-methylbutyl]-3-propylnon-8-en-1-amine;ethane;prop-1-yne (PubChem CID 142990160) has the molecular formula C30H67N and a molecular weight of 441.87 g/mol. Its IUPAC name is N,7-dimethyl-N-[(2S)-2-methylbutyl]-3-propylnon-8-en-1-amine;ethane;prop-1-yne.
| Compound Name | N,7-dimethyl-N-[(2S)-2-methylbutyl]-3-propylnon-8-en-1-amine;ethane;prop-1-yne |
|---|---|
| PubChem CID | 142990160 |
| Molecular Formula | C30H67N |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.53 |
| IUPAC Name | N,7-dimethyl-N-[(2S)-2-methylbutyl]-3-propylnon-8-en-1-amine;ethane;prop-1-yne |
| SMILES | C#CC.C=CC(C)CCCC(CCC)CCN(C)C[C@@H](C)CC.CC.CC.CC.CC |
| InChI | InChI=1S/C19H39N.C3H4.4C2H6/c1-7-11-19(13-10-12-17(4)8-2)14-15-20(6)16-18(5)9-3;1-3-2;4*1-2/h8,17-19H,2,7,9-16H2,1,3-6H3;1H,2H3;4*1-2H3/t17?,18-,19?;;;;;/m0...../s1 |
| InChIKey | KKPYUNVESSYAQU-SSXFSQKPSA-N |
| XLogP | 10.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|