C28H37F3N8O — CID 142990735
(1Z,3E)-5-N,5-N-diethyl-3-[2-morpholin-4-yl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrimidin-4-yl]hexa-1,3,5-triene-1,5-diamine (PubChem CID 142990735) has the molecular formula C28H37F3N8O and a molecular weight of 558.65 g/mol. Its IUPAC name is (1Z,3E)-5-N,5-N-diethyl-3-[2-morpholin-4-yl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrimidin-4-yl]hexa-1,3,5-triene-1,5-diamine.
| Compound Name | (1Z,3E)-5-N,5-N-diethyl-3-[2-morpholin-4-yl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrimidin-4-yl]hexa-1,3,5-triene-1,5-diamine |
|---|---|
| PubChem CID | 142990735 |
| Molecular Formula | C28H37F3N8O |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | (1Z,3E)-5-N,5-N-diethyl-3-[2-morpholin-4-yl-6-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrimidin-4-yl]hexa-1,3,5-triene-1,5-diamine |
| SMILES | C=C(/C=C(\C=C/N)c1cc(N2CCN(c3ncccc3C(F)(F)F)CC2)nc(N2CCOCC2)n1)N(CC)CC |
| InChI | InChI=1S/C28H37F3N8O/c1-4-36(5-2)21(3)19-22(8-9-32)24-20-25(35-27(34-24)39-15-17-40-18-16-39)37-11-13-38(14-12-37)26-23(28(29,30)31)7-6-10-33-26/h6-10,19-20H,3-5,11-18,32H2,1-2H3/b9-8-,22-19+ |
| InChIKey | QDYPHWSBBKAVIQ-VEPFGXTASA-N |
| XLogP | 3.76 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|