C11H15NO — CID 142992621
(4aZ,8Z,10E)-5-methyl-3,4,6,7-tetrahydro-2H-cycloocta[b][1,4]oxazine (PubChem CID 142992621) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (4aZ,8Z,10E)-5-methyl-3,4,6,7-tetrahydro-2H-cycloocta[b][1,4]oxazine.
| Compound Name | (4aZ,8Z,10E)-5-methyl-3,4,6,7-tetrahydro-2H-cycloocta[b][1,4]oxazine |
|---|---|
| PubChem CID | 142992621 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (4aZ,8Z,10E)-5-methyl-3,4,6,7-tetrahydro-2H-cycloocta[b][1,4]oxazine |
| SMILES | C/C1=C2\NCCO\C2=C\C=C/CC1 |
| InChI | InChI=1S/C11H15NO/c1-9-5-3-2-4-6-10-11(9)12-7-8-13-10/h2,4,6,12H,3,5,7-8H2,1H3/b4-2-,10-6+,11-9+ |
| InChIKey | JEULYXUZVSVMHQ-WRSJRZCCSA-N |
| XLogP | 2.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |