C16H23N3O2S — CID 142995207
2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide (PubChem CID 142995207) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide.
| Compound Name | 2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 142995207 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide |
| SMILES | CC1CNC(C)C1.CNS(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C10H10N2O2S.C6H13N/c1-11-15(13,14)10-4-2-3-8-7-12-6-5-9(8)10;1-5-3-6(2)7-4-5/h2-7,11H,1H3;5-7H,3-4H2,1-2H3 |
| InChIKey | WLWQURZWUMJLPU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |