About 2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide
2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide (PubChem CID 142995207) has the molecular formula C16H23N3O2S
and a molecular weight of 321.45 g/mol. Its IUPAC name is 2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide.
Molecular Properties
| Compound Name | 2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide |
| PubChem CID | 142995207 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide |
| SMILES | CC1CNC(C)C1.CNS(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C10H10N2O2S.C6H13N/c1-11-15(13,14)10-4-2-3-8-7-12-6-5-9(8)10;1-5-3-6(2)7-4-5/h2-7,11H,1H3;5-7H,3-4H2,1-2H3 |
| InChIKey | WLWQURZWUMJLPU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide?
The IUPAC name of 2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide (CID 142995207) is 2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide.
What is the SMILES notation for 2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide?
The canonical SMILES for 2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide is CC1CNC(C)C1.CNS(=O)(=O)c1cccc2cnccc12.
What is the InChIKey of 2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide?
The InChIKey is WLWQURZWUMJLPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S.C6H13N/c1-11-15(13,14)10-4-2-3-8-7-12-6-5-9(8)10;1-5-3-6(2)7-4-5/h2-7,11H,1H3;5-7H,3-4H2,1-2H3.
What are the key properties of 2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide?
2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide has a molecular weight of 321.45 g/mol, XLogP of 2.15, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpyrrolidine;N-methylisoquinoline-5-sulfonamide is sourced from PubChem (CID 142995207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).