C17H26N6O — CID 142996678
propan-2-yl N-methylidene-N'-[6-[(2-methylimidazol-1-yl)methyl]-5-propyl-4H-pyrimidin-3-yl]carbamimidate (PubChem CID 142996678) has the molecular formula C17H26N6O and a molecular weight of 330.44 g/mol. Its IUPAC name is propan-2-yl N-methylidene-N'-[6-[(2-methylimidazol-1-yl)methyl]-5-propyl-4H-pyrimidin-3-yl]carbamimidate.
| Compound Name | propan-2-yl N-methylidene-N'-[6-[(2-methylimidazol-1-yl)methyl]-5-propyl-4H-pyrimidin-3-yl]carbamimidate |
|---|---|
| PubChem CID | 142996678 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | propan-2-yl N-methylidene-N'-[6-[(2-methylimidazol-1-yl)methyl]-5-propyl-4H-pyrimidin-3-yl]carbamimidate |
| SMILES | C=N/C(=N\N1C=NC(Cn2ccnc2C)=C(CCC)C1)OC(C)C |
| InChI | InChI=1S/C17H26N6O/c1-6-7-15-10-23(21-17(18-5)24-13(2)3)12-20-16(15)11-22-9-8-19-14(22)4/h8-9,12-13H,5-7,10-11H2,1-4H3/b21-17+ |
| InChIKey | GDLUTNRWWGVSJH-HEHNFIMWSA-N |
| XLogP | 2.99 |
| TPSA | 67.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|