C16H26N6O — CID 142996729
2-hydroxy-2-methyl-N'-[6-[(2-methylimidazol-1-yl)methyl]-5-propyl-4H-pyrimidin-3-yl]propanimidamide (PubChem CID 142996729) has the molecular formula C16H26N6O and a molecular weight of 318.43 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-N'-[6-[(2-methylimidazol-1-yl)methyl]-5-propyl-4H-pyrimidin-3-yl]propanimidamide.
| Compound Name | 2-hydroxy-2-methyl-N'-[6-[(2-methylimidazol-1-yl)methyl]-5-propyl-4H-pyrimidin-3-yl]propanimidamide |
|---|---|
| PubChem CID | 142996729 |
| Molecular Formula | C16H26N6O |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2-hydroxy-2-methyl-N'-[6-[(2-methylimidazol-1-yl)methyl]-5-propyl-4H-pyrimidin-3-yl]propanimidamide |
| SMILES | CCCC1=C(Cn2ccnc2C)N=CN(/N=C(\N)C(C)(C)O)C1 |
| InChI | InChI=1S/C16H26N6O/c1-5-6-13-9-22(20-15(17)16(3,4)23)11-19-14(13)10-21-8-7-18-12(21)2/h7-8,11,23H,5-6,9-10H2,1-4H3,(H2,17,20) |
| InChIKey | UZIMTAJOBZKVKO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|