C17H26FN7O — CID 142996720
(2Z)-2-[6-[[2-(2-fluoropropanimidoyl)imidazol-1-yl]methyl]-5-propyl-4H-pyrimidin-3-yl]-2-(methylhydrazinylidene)ethanol (PubChem CID 142996720) has the molecular formula C17H26FN7O and a molecular weight of 363.44 g/mol. Its IUPAC name is (2Z)-2-[6-[[2-(2-fluoropropanimidoyl)imidazol-1-yl]methyl]-5-propyl-4H-pyrimidin-3-yl]-2-(methylhydrazinylidene)ethanol.
| Compound Name | (2Z)-2-[6-[[2-(2-fluoropropanimidoyl)imidazol-1-yl]methyl]-5-propyl-4H-pyrimidin-3-yl]-2-(methylhydrazinylidene)ethanol |
|---|---|
| PubChem CID | 142996720 |
| Molecular Formula | C17H26FN7O |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (2Z)-2-[6-[[2-(2-fluoropropanimidoyl)imidazol-1-yl]methyl]-5-propyl-4H-pyrimidin-3-yl]-2-(methylhydrazinylidene)ethanol |
| SMILES | [H]/N=C(/c1nccn1CC1=C(CCC)CN(/C(CO)=N\NC)C=N1)C(C)F |
| InChI | InChI=1S/C17H26FN7O/c1-4-5-13-8-25(15(10-26)23-20-3)11-22-14(13)9-24-7-6-21-17(24)16(19)12(2)18/h6-7,11-12,19-20,26H,4-5,8-10H2,1-3H3/b19-16+,23-15- |
| InChIKey | IUYNMMCLYOSSPZ-SKSWEPDJSA-N |
| XLogP | 1.53 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|