C20H32FN7O — CID 142996719
(2Z)-2-[6-[[2-(2-fluoropropanimidoyl)imidazol-1-yl]methyl]-5-propyl-4H-pyrimidin-3-yl]-2-(methylhydrazinylidene)ethanol;prop-1-ene (PubChem CID 142996719) has the molecular formula C20H32FN7O and a molecular weight of 405.52 g/mol. Its IUPAC name is (2Z)-2-[6-[[2-(2-fluoropropanimidoyl)imidazol-1-yl]methyl]-5-propyl-4H-pyrimidin-3-yl]-2-(methylhydrazinylidene)ethanol;prop-1-ene.
| Compound Name | (2Z)-2-[6-[[2-(2-fluoropropanimidoyl)imidazol-1-yl]methyl]-5-propyl-4H-pyrimidin-3-yl]-2-(methylhydrazinylidene)ethanol;prop-1-ene |
|---|---|
| PubChem CID | 142996719 |
| Molecular Formula | C20H32FN7O |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | (2Z)-2-[6-[[2-(2-fluoropropanimidoyl)imidazol-1-yl]methyl]-5-propyl-4H-pyrimidin-3-yl]-2-(methylhydrazinylidene)ethanol;prop-1-ene |
| SMILES | C=CC.[H]/N=C(/c1nccn1CC1=C(CCC)CN(/C(CO)=N\NC)C=N1)C(C)F |
| InChI | InChI=1S/C17H26FN7O.C3H6/c1-4-5-13-8-25(15(10-26)23-20-3)11-22-14(13)9-24-7-6-21-17(24)16(19)12(2)18;1-3-2/h6-7,11-12,19-20,26H,4-5,8-10H2,1-3H3;3H,1H2,2H3/b19-16+,23-15-; |
| InChIKey | FNYJRPPAUNXDSY-BBEXMZNSSA-N |
| XLogP | 2.72 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|