C22H32FN7O — CID 142996698
2-fluoro-N-[(Z)-pent-1-en-4-ynyl]ethanimine;2-methoxy-N'-[6-[(2-methylimidazol-1-yl)methyl]-5-propyl-4H-pyrimidin-3-yl]ethanimidamide (PubChem CID 142996698) has the molecular formula C22H32FN7O and a molecular weight of 429.54 g/mol. Its IUPAC name is 2-fluoro-N-[(Z)-pent-1-en-4-ynyl]ethanimine;2-methoxy-N'-[6-[(2-methylimidazol-1-yl)methyl]-5-propyl-4H-pyrimidin-3-yl]ethanimidamide.
| Compound Name | 2-fluoro-N-[(Z)-pent-1-en-4-ynyl]ethanimine;2-methoxy-N'-[6-[(2-methylimidazol-1-yl)methyl]-5-propyl-4H-pyrimidin-3-yl]ethanimidamide |
|---|---|
| PubChem CID | 142996698 |
| Molecular Formula | C22H32FN7O |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 2-fluoro-N-[(Z)-pent-1-en-4-ynyl]ethanimine;2-methoxy-N'-[6-[(2-methylimidazol-1-yl)methyl]-5-propyl-4H-pyrimidin-3-yl]ethanimidamide |
| SMILES | C#CC/C=C\N=C\CF.CCCC1=C(Cn2ccnc2C)N=CN(/N=C(\N)COC)C1 |
| InChI | InChI=1S/C15H24N6O.C7H8FN/c1-4-5-13-8-21(19-15(16)10-22-3)11-18-14(13)9-20-7-6-17-12(20)2;1-2-3-4-6-9-7-5-8/h6-7,11H,4-5,8-10H2,1-3H3,(H2,16,19);1,4,6-7H,3,5H2/b;6-4-,9-7+ |
| InChIKey | OAQJFZGFPNBLKD-DNHGSZRKSA-N |
| XLogP | 3.07 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|