C19H32FN7O — CID 142996610
but-1-ene;2-fluoroethanimine;methyl N'-[6-(imidazol-1-ylmethyl)-5-propyl-4H-pyrimidin-3-yl]carbamimidate (PubChem CID 142996610) has the molecular formula C19H32FN7O and a molecular weight of 393.51 g/mol. Its IUPAC name is but-1-ene;2-fluoroethanimine;methyl N'-[6-(imidazol-1-ylmethyl)-5-propyl-4H-pyrimidin-3-yl]carbamimidate.
| Compound Name | but-1-ene;2-fluoroethanimine;methyl N'-[6-(imidazol-1-ylmethyl)-5-propyl-4H-pyrimidin-3-yl]carbamimidate |
|---|---|
| PubChem CID | 142996610 |
| Molecular Formula | C19H32FN7O |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | but-1-ene;2-fluoroethanimine;methyl N'-[6-(imidazol-1-ylmethyl)-5-propyl-4H-pyrimidin-3-yl]carbamimidate |
| SMILES | C=CCC.CCCC1=C(Cn2ccnc2)N=CN(/N=C(\N)OC)C1.[H]/N=C/CF |
| InChI | InChI=1S/C13H20N6O.C4H8.C2H4FN/c1-3-4-11-7-19(17-13(14)20-2)10-16-12(11)8-18-6-5-15-9-18;1-3-4-2;3-1-2-4/h5-6,9-10H,3-4,7-8H2,1-2H3,(H2,14,17);3H,1,4H2,2H3;2,4H,1H2/b;;4-2+ |
| InChIKey | DRSJQHWRZBQJTD-KVDNZAPZSA-N |
| XLogP | 3.35 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|