C17H28N6O — CID 142996708
N'-[6-(imidazol-1-ylmethyl)-5-propyl-4H-pyrimidin-3-yl]-2-methoxypentanimidamide (PubChem CID 142996708) has the molecular formula C17H28N6O and a molecular weight of 332.45 g/mol. Its IUPAC name is N'-[6-(imidazol-1-ylmethyl)-5-propyl-4H-pyrimidin-3-yl]-2-methoxypentanimidamide.
| Compound Name | N'-[6-(imidazol-1-ylmethyl)-5-propyl-4H-pyrimidin-3-yl]-2-methoxypentanimidamide |
|---|---|
| PubChem CID | 142996708 |
| Molecular Formula | C17H28N6O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | N'-[6-(imidazol-1-ylmethyl)-5-propyl-4H-pyrimidin-3-yl]-2-methoxypentanimidamide |
| SMILES | CCCC1=C(Cn2ccnc2)N=CN(/N=C(\N)C(CCC)OC)C1 |
| InChI | InChI=1S/C17H28N6O/c1-4-6-14-10-23(21-17(18)16(24-3)7-5-2)13-20-15(14)11-22-9-8-19-12-22/h8-9,12-13,16H,4-7,10-11H2,1-3H3,(H2,18,21) |
| InChIKey | WFEWHBDGNHOTOX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|