C25H26N2O2S — CID 142996803
O-[4-[(4-hydroxy-4-phenylpiperidin-1-yl)methyl]phenyl] N-phenylcarbamothioate (PubChem CID 142996803) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is O-[4-[(4-hydroxy-4-phenylpiperidin-1-yl)methyl]phenyl] N-phenylcarbamothioate.
| Compound Name | O-[4-[(4-hydroxy-4-phenylpiperidin-1-yl)methyl]phenyl] N-phenylcarbamothioate |
|---|---|
| PubChem CID | 142996803 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | O-[4-[(4-hydroxy-4-phenylpiperidin-1-yl)methyl]phenyl] N-phenylcarbamothioate |
| SMILES | OC1(c2ccccc2)CCN(Cc2ccc(OC(=S)Nc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C25H26N2O2S/c28-25(21-7-3-1-4-8-21)15-17-27(18-16-25)19-20-11-13-23(14-12-20)29-24(30)26-22-9-5-2-6-10-22/h1-14,28H,15-19H2,(H,26,30) |
| InChIKey | IHKKNFKEQWQKFI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|