C22H27NO5 — CID 142997343
2-(hydroxymethyl)-6-[3-[[(E)-3-(4-methoxyphenyl)prop-1-enyl]amino]phenoxy]oxan-4-ol (PubChem CID 142997343) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[3-[[(E)-3-(4-methoxyphenyl)prop-1-enyl]amino]phenoxy]oxan-4-ol.
| Compound Name | 2-(hydroxymethyl)-6-[3-[[(E)-3-(4-methoxyphenyl)prop-1-enyl]amino]phenoxy]oxan-4-ol |
|---|---|
| PubChem CID | 142997343 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2-(hydroxymethyl)-6-[3-[[(E)-3-(4-methoxyphenyl)prop-1-enyl]amino]phenoxy]oxan-4-ol |
| SMILES | COc1ccc(C/C=C/Nc2cccc(OC3CC(O)CC(CO)O3)c2)cc1 |
| InChI | InChI=1S/C22H27NO5/c1-26-19-9-7-16(8-10-19)4-3-11-23-17-5-2-6-20(12-17)27-22-14-18(25)13-21(15-24)28-22/h2-3,5-12,18,21-25H,4,13-15H2,1H3/b11-3+ |
| InChIKey | CJMGYBFTNZJTRN-QDEBKDIKSA-N |
| XLogP | 3.10 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |