C15H22O6 — CID 167261885
(2S,4S,6S)-2-[[hydroxy-(4-methoxyphenyl)methoxy]methyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 167261885) has the molecular formula C15H22O6 and a molecular weight of 298.33 g/mol. Its IUPAC name is (2S,4S,6S)-2-[[hydroxy-(4-methoxyphenyl)methoxy]methyl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | (2S,4S,6S)-2-[[hydroxy-(4-methoxyphenyl)methoxy]methyl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 167261885 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (2S,4S,6S)-2-[[hydroxy-(4-methoxyphenyl)methoxy]methyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | COc1ccc(C(O)OC[C@@H]2C[C@@H](O)C[C@@H](CO)O2)cc1 |
| InChI | InChI=1S/C15H22O6/c1-19-12-4-2-10(3-5-12)15(18)20-9-14-7-11(17)6-13(8-16)21-14/h2-5,11,13-18H,6-9H2,1H3/t11-,13-,14-,15?/m0/s1 |
| InChIKey | GNPYRMZZEZZCEO-YMYGFNRBSA-N |
| XLogP | 0.60 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|