C24H37N3O3 — CID 142998015
butyl 5-[4-(1-cyclobutylpiperidin-4-yl)oxypiperidin-1-yl]pyridine-2-carboxylate (PubChem CID 142998015) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is butyl 5-[4-(1-cyclobutylpiperidin-4-yl)oxypiperidin-1-yl]pyridine-2-carboxylate.
| Compound Name | butyl 5-[4-(1-cyclobutylpiperidin-4-yl)oxypiperidin-1-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 142998015 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | butyl 5-[4-(1-cyclobutylpiperidin-4-yl)oxypiperidin-1-yl]pyridine-2-carboxylate |
| SMILES | CCCCOC(=O)c1ccc(N2CCC(OC3CCN(C4CCC4)CC3)CC2)cn1 |
| InChI | InChI=1S/C24H37N3O3/c1-2-3-17-29-24(28)23-8-7-20(18-25-23)27-15-11-22(12-16-27)30-21-9-13-26(14-10-21)19-5-4-6-19/h7-8,18-19,21-22H,2-6,9-17H2,1H3 |
| InChIKey | KFGHOUHXDOSPAK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|