C9H12F3NO — CID 142998132
2,2,2-trifluoro-1-(3-methyl-4-methylidenepiperidin-1-yl)ethanone (PubChem CID 142998132) has the molecular formula C9H12F3NO and a molecular weight of 207.19 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(3-methyl-4-methylidenepiperidin-1-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(3-methyl-4-methylidenepiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 142998132 |
| Molecular Formula | C9H12F3NO |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2,2,2-trifluoro-1-(3-methyl-4-methylidenepiperidin-1-yl)ethanone |
| SMILES | C=C1CCN(C(=O)C(F)(F)F)CC1C |
| InChI | InChI=1S/C9H12F3NO/c1-6-3-4-13(5-7(6)2)8(14)9(10,11)12/h7H,1,3-5H2,2H3 |
| InChIKey | ZGVKWHWREUEYSO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|