C15H15F3N2O2 — CID 23654200
1-(6,10-dimethyl-4-oxa-2,12-diazatricyclo[7.5.0.03,7]tetradeca-1(9),2,5,7-tetraen-12-yl)-2,2,2-trifluoroethanone (PubChem CID 23654200) has the molecular formula C15H15F3N2O2 and a molecular weight of 312.29 g/mol. Its IUPAC name is 1-(6,10-dimethyl-4-oxa-2,12-diazatricyclo[7.5.0.03,7]tetradeca-1(9),2,5,7-tetraen-12-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(6,10-dimethyl-4-oxa-2,12-diazatricyclo[7.5.0.03,7]tetradeca-1(9),2,5,7-tetraen-12-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 23654200 |
| Molecular Formula | C15H15F3N2O2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-(6,10-dimethyl-4-oxa-2,12-diazatricyclo[7.5.0.03,7]tetradeca-1(9),2,5,7-tetraen-12-yl)-2,2,2-trifluoroethanone |
| SMILES | Cc1coc2nc3c(cc12)C(C)CN(C(=O)C(F)(F)F)CC3 |
| InChI | InChI=1S/C15H15F3N2O2/c1-8-6-20(14(21)15(16,17)18)4-3-12-10(8)5-11-9(2)7-22-13(11)19-12/h5,7-8H,3-4,6H2,1-2H3 |
| InChIKey | LPLZBFXASOOCAI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |