C28H39NO2 — CID 142999885
[2-methyl-4-[2-[4-(4-nonylphenyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methanol (PubChem CID 142999885) has the molecular formula C28H39NO2 and a molecular weight of 421.63 g/mol. Its IUPAC name is [2-methyl-4-[2-[4-(4-nonylphenyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methanol.
| Compound Name | [2-methyl-4-[2-[4-(4-nonylphenyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 142999885 |
| Molecular Formula | C28H39NO2 |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.30 |
| IUPAC Name | [2-methyl-4-[2-[4-(4-nonylphenyl)phenyl]ethyl]-5H-1,3-oxazol-4-yl]methanol |
| SMILES | CCCCCCCCCc1ccc(-c2ccc(CCC3(CO)COC(C)=N3)cc2)cc1 |
| InChI | InChI=1S/C28H39NO2/c1-3-4-5-6-7-8-9-10-24-11-15-26(16-12-24)27-17-13-25(14-18-27)19-20-28(21-30)22-31-23(2)29-28/h11-18,30H,3-10,19-22H2,1-2H3 |
| InChIKey | LPMFJYRSLYURPF-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|