C33H27F6N3O3 — CID 143002051
N-[1-(1-aminoethylideneamino)-1-oxo-3-(4-phenylphenyl)propan-2-yl]-5-[3,5-bis(trifluoromethyl)phenyl]-2-methoxybenzamide (PubChem CID 143002051) has the molecular formula C33H27F6N3O3 and a molecular weight of 627.59 g/mol. Its IUPAC name is N-[1-(1-aminoethylideneamino)-1-oxo-3-(4-phenylphenyl)propan-2-yl]-5-[3,5-bis(trifluoromethyl)phenyl]-2-methoxybenzamide.
| Compound Name | N-[1-(1-aminoethylideneamino)-1-oxo-3-(4-phenylphenyl)propan-2-yl]-5-[3,5-bis(trifluoromethyl)phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 143002051 |
| Molecular Formula | C33H27F6N3O3 |
| Molecular Weight | 627.59 g/mol |
| Exact Mass | 627.20 |
| IUPAC Name | N-[1-(1-aminoethylideneamino)-1-oxo-3-(4-phenylphenyl)propan-2-yl]-5-[3,5-bis(trifluoromethyl)phenyl]-2-methoxybenzamide |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1C(=O)NC(Cc1ccc(-c2ccccc2)cc1)C(=O)/N=C(\C)N |
| InChI | InChI=1S/C33H27F6N3O3/c1-19(40)41-31(44)28(14-20-8-10-22(11-9-20)21-6-4-3-5-7-21)42-30(43)27-17-23(12-13-29(27)45-2)24-15-25(32(34,35)36)18-26(16-24)33(37,38)39/h3-13,15-18,28H,14H2,1-2H3,(H,42,43)(H2,40,41,44) |
| InChIKey | WFADJIMVEBYFDX-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.59 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|