C18H17N5 — CID 143002491
N-[amino-[(2-phenylquinolin-4-yl)amino]methylidene]-N'-methylmethanimidamide (PubChem CID 143002491) has the molecular formula C18H17N5 and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[amino-[(2-phenylquinolin-4-yl)amino]methylidene]-N'-methylmethanimidamide.
| Compound Name | N-[amino-[(2-phenylquinolin-4-yl)amino]methylidene]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 143002491 |
| Molecular Formula | C18H17N5 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | N-[amino-[(2-phenylquinolin-4-yl)amino]methylidene]-N'-methylmethanimidamide |
| SMILES | C/N=C/N=C(\N)Nc1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C18H17N5/c1-20-12-21-18(19)23-17-11-16(13-7-3-2-4-8-13)22-15-10-6-5-9-14(15)17/h2-12H,1H3,(H3,19,20,21,22,23) |
| InChIKey | UIUDBURNLMZMBK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|