C12H16N2 — CID 143003977
N-[(Z)-1-(1,2,3,6-tetrahydropyridin-5-yl)but-1-en-3-ynyl]propan-1-imine (PubChem CID 143003977) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N-[(Z)-1-(1,2,3,6-tetrahydropyridin-5-yl)but-1-en-3-ynyl]propan-1-imine.
| Compound Name | N-[(Z)-1-(1,2,3,6-tetrahydropyridin-5-yl)but-1-en-3-ynyl]propan-1-imine |
|---|---|
| PubChem CID | 143003977 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N-[(Z)-1-(1,2,3,6-tetrahydropyridin-5-yl)but-1-en-3-ynyl]propan-1-imine |
| SMILES | C#C/C=C(\N=C\CC)C1=CCCNC1 |
| InChI | InChI=1S/C12H16N2/c1-3-6-12(14-8-4-2)11-7-5-9-13-10-11/h1,6-8,13H,4-5,9-10H2,2H3/b12-6-,14-8+ |
| InChIKey | HIKVSSXCEIOXEY-VAFXGQJBSA-N |
| XLogP | 1.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|