C19H28N2 — CID 143003980
(2Z,4Z)-6-[1-(cyclohepta-1,3,6-trien-1-ylmethyl)piperidin-3-yl]hexa-2,4-dien-2-amine (PubChem CID 143003980) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is (2Z,4Z)-6-[1-(cyclohepta-1,3,6-trien-1-ylmethyl)piperidin-3-yl]hexa-2,4-dien-2-amine.
| Compound Name | (2Z,4Z)-6-[1-(cyclohepta-1,3,6-trien-1-ylmethyl)piperidin-3-yl]hexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 143003980 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | (2Z,4Z)-6-[1-(cyclohepta-1,3,6-trien-1-ylmethyl)piperidin-3-yl]hexa-2,4-dien-2-amine |
| SMILES | C/C(N)=C/C=C\CC1CCCN(CC2=CC=CCC=C2)C1 |
| InChI | InChI=1S/C19H28N2/c1-17(20)9-6-7-12-19-13-8-14-21(16-19)15-18-10-4-2-3-5-11-18/h2,4-7,9-11,19H,3,8,12-16,20H2,1H3/b7-6-,17-9- |
| InChIKey | YVEDFYZYNYORAG-SKTWDZOCSA-N |
| XLogP | 3.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|