About ethane;1-ethyl-3-octylbenzene;N-sulfanylacetamide
ethane;1-ethyl-3-octylbenzene;N-sulfanylacetamide (PubChem CID 143004513) has the molecular formula C20H37NOS
and a molecular weight of 339.59 g/mol. Its IUPAC name is ethane;1-ethyl-3-octylbenzene;N-sulfanylacetamide.
Molecular Properties
| Compound Name | ethane;1-ethyl-3-octylbenzene;N-sulfanylacetamide |
| PubChem CID | 143004513 |
| Molecular Formula | C20H37NOS |
| Molecular Weight | 339.59 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | ethane;1-ethyl-3-octylbenzene;N-sulfanylacetamide |
| SMILES | CC.CC(=O)NS.CCCCCCCCc1cccc(CC)c1 |
| InChI | InChI=1S/C16H26.C2H5NOS.C2H6/c1-3-5-6-7-8-9-11-16-13-10-12-15(4-2)14-16;1-2(4)3-5;1-2/h10,12-14H,3-9,11H2,1-2H3;5H,1H3,(H,3,4);1-2H3 |
| InChIKey | HSNKCPQGNXHZIX-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethyl-3-octylbenzene;N-sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-3-octylbenzene;N-sulfanylacetamide?
The IUPAC name of ethane;1-ethyl-3-octylbenzene;N-sulfanylacetamide (CID 143004513) is ethane;1-ethyl-3-octylbenzene;N-sulfanylacetamide.
What is the SMILES notation for ethane;1-ethyl-3-octylbenzene;N-sulfanylacetamide?
The canonical SMILES for ethane;1-ethyl-3-octylbenzene;N-sulfanylacetamide is CC.CC(=O)NS.CCCCCCCCc1cccc(CC)c1.
What is the InChIKey of ethane;1-ethyl-3-octylbenzene;N-sulfanylacetamide?
The InChIKey is HSNKCPQGNXHZIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26.C2H5NOS.C2H6/c1-3-5-6-7-8-9-11-16-13-10-12-15(4-2)14-16;1-2(4)3-5;1-2/h10,12-14H,3-9,11H2,1-2H3;5H,1H3,(H,3,4);1-2H3.
What are the key properties of ethane;1-ethyl-3-octylbenzene;N-sulfanylacetamide?
ethane;1-ethyl-3-octylbenzene;N-sulfanylacetamide has a molecular weight of 339.59 g/mol, XLogP of 6.15, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-3-octylbenzene;N-sulfanylacetamide is sourced from PubChem (CID 143004513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).