C19H17ClN6O2S — CID 143005184
2-[2-chloro-4-[[6-(4,5-dihydro-1,3-oxazol-2-ylamino)quinazolin-4-yl]amino]phenoxy]ethanethioamide (PubChem CID 143005184) has the molecular formula C19H17ClN6O2S and a molecular weight of 428.91 g/mol. Its IUPAC name is 2-[2-chloro-4-[[6-(4,5-dihydro-1,3-oxazol-2-ylamino)quinazolin-4-yl]amino]phenoxy]ethanethioamide.
| Compound Name | 2-[2-chloro-4-[[6-(4,5-dihydro-1,3-oxazol-2-ylamino)quinazolin-4-yl]amino]phenoxy]ethanethioamide |
|---|---|
| PubChem CID | 143005184 |
| Molecular Formula | C19H17ClN6O2S |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 2-[2-chloro-4-[[6-(4,5-dihydro-1,3-oxazol-2-ylamino)quinazolin-4-yl]amino]phenoxy]ethanethioamide |
| SMILES | NC(=S)COc1ccc(Nc2ncnc3ccc(NC4=NCCO4)cc23)cc1Cl |
| InChI | InChI=1S/C19H17ClN6O2S/c20-14-8-12(2-4-16(14)28-9-17(21)29)25-18-13-7-11(26-19-22-5-6-27-19)1-3-15(13)23-10-24-18/h1-4,7-8,10H,5-6,9H2,(H2,21,29)(H,22,26)(H,23,24,25) |
| InChIKey | FGFCBIBYXXQQRK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|