C21H22N2O3S — CID 143008889
(2E,4E)-5-ethenyl-8-formamido-N-hydroxy-2-methylocta-2,4-dien-6-ynamide;2-methyl-1-benzothiophene (PubChem CID 143008889) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is (2E,4E)-5-ethenyl-8-formamido-N-hydroxy-2-methylocta-2,4-dien-6-ynamide;2-methyl-1-benzothiophene.
| Compound Name | (2E,4E)-5-ethenyl-8-formamido-N-hydroxy-2-methylocta-2,4-dien-6-ynamide;2-methyl-1-benzothiophene |
|---|---|
| PubChem CID | 143008889 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (2E,4E)-5-ethenyl-8-formamido-N-hydroxy-2-methylocta-2,4-dien-6-ynamide;2-methyl-1-benzothiophene |
| SMILES | C=C/C(C#CCNC=O)=C\C=C(/C)C(=O)NO.Cc1cc2ccccc2s1 |
| InChI | InChI=1S/C12H14N2O3.C9H8S/c1-3-11(5-4-8-13-9-15)7-6-10(2)12(16)14-17;1-7-6-8-4-2-3-5-9(8)10-7/h3,6-7,9,17H,1,8H2,2H3,(H,13,15)(H,14,16);2-6H,1H3/b10-6+,11-7+; |
| InChIKey | IUOCYWZXUDVORX-MODGIHDZSA-N |
| XLogP | 3.51 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|