C12H14N2O3 — CID 143008890
(2E,4E)-5-ethenyl-8-formamido-N-hydroxy-2-methylocta-2,4-dien-6-ynamide (PubChem CID 143008890) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is (2E,4E)-5-ethenyl-8-formamido-N-hydroxy-2-methylocta-2,4-dien-6-ynamide.
| Compound Name | (2E,4E)-5-ethenyl-8-formamido-N-hydroxy-2-methylocta-2,4-dien-6-ynamide |
|---|---|
| PubChem CID | 143008890 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (2E,4E)-5-ethenyl-8-formamido-N-hydroxy-2-methylocta-2,4-dien-6-ynamide |
| SMILES | C=C/C(C#CCNC=O)=C\C=C(/C)C(=O)NO |
| InChI | InChI=1S/C12H14N2O3/c1-3-11(5-4-8-13-9-15)7-6-10(2)12(16)14-17/h3,6-7,9,17H,1,8H2,2H3,(H,13,15)(H,14,16)/b10-6+,11-7+ |
| InChIKey | HVJLGRKUFDXNPF-JMQWPVDRSA-N |
| XLogP | 0.30 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|