C17H19N — CID 143010057
5,9,13-trimethyl-9-azatricyclo[8.5.0.02,8]pentadeca-1(10),2(8),3,6,11,14-hexaene (PubChem CID 143010057) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is 5,9,13-trimethyl-9-azatricyclo[8.5.0.02,8]pentadeca-1(10),2(8),3,6,11,14-hexaene.
| Compound Name | 5,9,13-trimethyl-9-azatricyclo[8.5.0.02,8]pentadeca-1(10),2(8),3,6,11,14-hexaene |
|---|---|
| PubChem CID | 143010057 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 5,9,13-trimethyl-9-azatricyclo[8.5.0.02,8]pentadeca-1(10),2(8),3,6,11,14-hexaene |
| SMILES | CC1C=Cc2c3c(n(C)c2C=C1)C=CC(C)C=C3 |
| InChI | InChI=1S/C17H19N/c1-12-4-8-14-15-9-5-13(2)7-11-17(15)18(3)16(14)10-6-12/h4-13H,1-3H3 |
| InChIKey | KPXGKOKWJMXDMR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |