C11H15N — CID 143655105
1,6-dimethyl-3,6-dihydro-2H-cyclohepta[b]pyrrole (PubChem CID 143655105) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 1,6-dimethyl-3,6-dihydro-2H-cyclohepta[b]pyrrole.
| Compound Name | 1,6-dimethyl-3,6-dihydro-2H-cyclohepta[b]pyrrole |
|---|---|
| PubChem CID | 143655105 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 1,6-dimethyl-3,6-dihydro-2H-cyclohepta[b]pyrrole |
| SMILES | CC1C=CC2=C(C=C1)N(C)CC2 |
| InChI | InChI=1S/C11H15N/c1-9-3-5-10-7-8-12(2)11(10)6-4-9/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | MBAFVIRIHOKTHB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |