About 5-methylsulfinyl-1H-1,2,4-triazole;molecular hydrogen
5-methylsulfinyl-1H-1,2,4-triazole;molecular hydrogen (PubChem CID 143010299) has the molecular formula C3H7N3OS
and a molecular weight of 133.18 g/mol. Its IUPAC name is 5-methylsulfinyl-1H-1,2,4-triazole;molecular hydrogen.
Analyze 5-methylsulfinyl-1H-1,2,4-triazole;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfinyl-1H-1,2,4-triazole;molecular hydrogen?
The IUPAC name of 5-methylsulfinyl-1H-1,2,4-triazole;molecular hydrogen (CID 143010299) is 5-methylsulfinyl-1H-1,2,4-triazole;molecular hydrogen.
What is the SMILES notation for 5-methylsulfinyl-1H-1,2,4-triazole;molecular hydrogen?
The canonical SMILES for 5-methylsulfinyl-1H-1,2,4-triazole;molecular hydrogen is CS(=O)c1ncn[nH]1.[H][H].
What is the InChIKey of 5-methylsulfinyl-1H-1,2,4-triazole;molecular hydrogen?
The InChIKey is YWQRSGUTMBPXTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3OS.H2/c1-8(7)3-4-2-5-6-3;/h2H,1H3,(H,4,5,6);1H.
What are the key properties of 5-methylsulfinyl-1H-1,2,4-triazole;molecular hydrogen?
5-methylsulfinyl-1H-1,2,4-triazole;molecular hydrogen has a molecular weight of 133.18 g/mol, XLogP of -0.21, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfinyl-1H-1,2,4-triazole;molecular hydrogen is sourced from PubChem (CID 143010299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).