C24H27FN4O — CID 143013336
4-[4-(5-ethyl-2-pyrrolidin-1-ylbenzoyl)piperazin-1-yl]-2-fluorobenzonitrile (PubChem CID 143013336) has the molecular formula C24H27FN4O and a molecular weight of 406.51 g/mol. Its IUPAC name is 4-[4-(5-ethyl-2-pyrrolidin-1-ylbenzoyl)piperazin-1-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[4-(5-ethyl-2-pyrrolidin-1-ylbenzoyl)piperazin-1-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 143013336 |
| Molecular Formula | C24H27FN4O |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 4-[4-(5-ethyl-2-pyrrolidin-1-ylbenzoyl)piperazin-1-yl]-2-fluorobenzonitrile |
| SMILES | CCc1ccc(N2CCCC2)c(C(=O)N2CCN(c3ccc(C#N)c(F)c3)CC2)c1 |
| InChI | InChI=1S/C24H27FN4O/c1-2-18-5-8-23(28-9-3-4-10-28)21(15-18)24(30)29-13-11-27(12-14-29)20-7-6-19(17-26)22(25)16-20/h5-8,15-16H,2-4,9-14H2,1H3 |
| InChIKey | QLXWFDYMWMFXRJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |