C15H15BrClFN2O2 — CID 143014691
methyl (2Z,4Z)-5-amino-3-(4-bromo-2-chloroanilino)-2-ethenyl-4-fluorohexa-2,4-dienoate (PubChem CID 143014691) has the molecular formula C15H15BrClFN2O2 and a molecular weight of 389.65 g/mol. Its IUPAC name is methyl (2Z,4Z)-5-amino-3-(4-bromo-2-chloroanilino)-2-ethenyl-4-fluorohexa-2,4-dienoate.
| Compound Name | methyl (2Z,4Z)-5-amino-3-(4-bromo-2-chloroanilino)-2-ethenyl-4-fluorohexa-2,4-dienoate |
|---|---|
| PubChem CID | 143014691 |
| Molecular Formula | C15H15BrClFN2O2 |
| Molecular Weight | 389.65 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | methyl (2Z,4Z)-5-amino-3-(4-bromo-2-chloroanilino)-2-ethenyl-4-fluorohexa-2,4-dienoate |
| SMILES | C=C/C(C(=O)OC)=C(Nc1ccc(Br)cc1Cl)\C(F)=C(/C)N |
| InChI | InChI=1S/C15H15BrClFN2O2/c1-4-10(15(21)22-3)14(13(18)8(2)19)20-12-6-5-9(16)7-11(12)17/h4-7,20H,1,19H2,2-3H3/b13-8-,14-10- |
| InChIKey | URLWRDAPSINVAB-GSPAGQKZSA-N |
| XLogP | 4.29 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.65 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|