C32H38N3O7S+ — CID 143015544
CID 143015544 (PubChem CID 143015544) has the molecular formula C32H38N3O7S+ and a molecular weight of 608.74 g/mol.
| Compound Name | CID 143015544 |
|---|---|
| PubChem CID | 143015544 |
| Molecular Formula | C32H38N3O7S+ |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | — |
| SMILES | COc1c(N[S+](C)(=O)O)cc(C(C)(C)C)cc1N1C(=O)C=C(c2ccc(OCCN3CCOCC3)c3ccccc23)C1=O |
| InChI | InChI=1S/C32H37N3O7S/c1-32(2,3)21-18-26(33-43(5,38)39)30(40-4)27(19-21)35-29(36)20-25(31(35)37)23-10-11-28(24-9-7-6-8-22(23)24)42-17-14-34-12-15-41-16-13-34/h6-11,18-20H,12-17H2,1-5H3,(H-,33,38,39)/p+1 |
| InChIKey | SMSKMFURNLHAQO-UHFFFAOYSA-O |
| XLogP | 4.74 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|