C21H29N3O2 — CID 143018487
2-(2-aminoethoxymethyl)-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-7,7-dimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 143018487) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-(2-aminoethoxymethyl)-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-7,7-dimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-(2-aminoethoxymethyl)-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-7,7-dimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 143018487 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 2-(2-aminoethoxymethyl)-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-7,7-dimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | C/C=C\C(=C/C)C1C(C#N)=C(COCCN)NC2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C21H29N3O2/c1-5-7-14(6-2)19-15(12-23)17(13-26-9-8-22)24-16-10-21(3,4)11-18(25)20(16)19/h5-7,19,24H,8-11,13,22H2,1-4H3/b7-5-,14-6+ |
| InChIKey | NKKMVRDLIUQUKB-CYMBIFCZSA-N |
| XLogP | 3.12 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|