C17H26N4O2S — CID 143018519
2-(2-aminoethoxymethyl)-7,7-dimethyl-3-[(methylideneamino)methyl]-5-oxo-1,4,6,8-tetrahydroquinoline-4-carbothioamide (PubChem CID 143018519) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is 2-(2-aminoethoxymethyl)-7,7-dimethyl-3-[(methylideneamino)methyl]-5-oxo-1,4,6,8-tetrahydroquinoline-4-carbothioamide.
| Compound Name | 2-(2-aminoethoxymethyl)-7,7-dimethyl-3-[(methylideneamino)methyl]-5-oxo-1,4,6,8-tetrahydroquinoline-4-carbothioamide |
|---|---|
| PubChem CID | 143018519 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-(2-aminoethoxymethyl)-7,7-dimethyl-3-[(methylideneamino)methyl]-5-oxo-1,4,6,8-tetrahydroquinoline-4-carbothioamide |
| SMILES | C=NCC1=C(COCCN)NC2=C(C(=O)CC(C)(C)C2)C1C(N)=S |
| InChI | InChI=1S/C17H26N4O2S/c1-17(2)6-11-15(13(22)7-17)14(16(19)24)10(8-20-3)12(21-11)9-23-5-4-18/h14,21H,3-9,18H2,1-2H3,(H2,19,24) |
| InChIKey | VGVBTIZLBHXELD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|