C39H34N2 — CID 143019222
N-[(2Z,4Z)-hepta-2,4-dien-6-ynyl]-3-methyl-N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]aniline (PubChem CID 143019222) has the molecular formula C39H34N2 and a molecular weight of 530.72 g/mol. Its IUPAC name is N-[(2Z,4Z)-hepta-2,4-dien-6-ynyl]-3-methyl-N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]aniline.
| Compound Name | N-[(2Z,4Z)-hepta-2,4-dien-6-ynyl]-3-methyl-N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 143019222 |
| Molecular Formula | C39H34N2 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | N-[(2Z,4Z)-hepta-2,4-dien-6-ynyl]-3-methyl-N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]aniline |
| SMILES | C#C/C=C\C=C/CN(c1ccc(-c2ccc(N(c3ccccc3)c3cccc(C)c3)cc2)cc1)c1cccc(C)c1 |
| InChI | InChI=1S/C39H34N2/c1-4-5-6-7-11-28-40(38-18-12-14-31(2)29-38)35-24-20-33(21-25-35)34-22-26-37(27-23-34)41(36-16-9-8-10-17-36)39-19-13-15-32(3)30-39/h1,5-27,29-30H,28H2,2-3H3/b6-5-,11-7- |
| InChIKey | JFLIXBIHIJUVAH-FUVGTJSASA-N |
| XLogP | 10.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|