C15H28N2 — CID 143021132
N'-[(2E)-4,5-dimethyl-3-prop-1-en-2-ylhexa-2,4-dien-2-yl]ethanimidamide;ethane (PubChem CID 143021132) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is N'-[(2E)-4,5-dimethyl-3-prop-1-en-2-ylhexa-2,4-dien-2-yl]ethanimidamide;ethane.
| Compound Name | N'-[(2E)-4,5-dimethyl-3-prop-1-en-2-ylhexa-2,4-dien-2-yl]ethanimidamide;ethane |
|---|---|
| PubChem CID | 143021132 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | N'-[(2E)-4,5-dimethyl-3-prop-1-en-2-ylhexa-2,4-dien-2-yl]ethanimidamide;ethane |
| SMILES | C=C(C)/C(C(C)=C(C)C)=C(C)\N=C(/C)N.CC |
| InChI | InChI=1S/C13H22N2.C2H6/c1-8(2)10(5)13(9(3)4)11(6)15-12(7)14;1-2/h3H2,1-2,4-7H3,(H2,14,15);1-2H3/b13-11+; |
| InChIKey | XJTFDTZRWLDCHK-BNSHTTSQSA-N |
| XLogP | 4.60 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|