C20H24N4O6S2 — CID 143022326
2-[5-[(4-acetamidophenyl)sulfonylamino]-2-ethylbenzimidazol-1-yl]ethyl methanesulfonate (PubChem CID 143022326) has the molecular formula C20H24N4O6S2 and a molecular weight of 480.57 g/mol. Its IUPAC name is 2-[5-[(4-acetamidophenyl)sulfonylamino]-2-ethylbenzimidazol-1-yl]ethyl methanesulfonate.
| Compound Name | 2-[5-[(4-acetamidophenyl)sulfonylamino]-2-ethylbenzimidazol-1-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 143022326 |
| Molecular Formula | C20H24N4O6S2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 2-[5-[(4-acetamidophenyl)sulfonylamino]-2-ethylbenzimidazol-1-yl]ethyl methanesulfonate |
| SMILES | CCc1nc2cc(NS(=O)(=O)c3ccc(NC(C)=O)cc3)ccc2n1CCOS(C)(=O)=O |
| InChI | InChI=1S/C20H24N4O6S2/c1-4-20-22-18-13-16(7-10-19(18)24(20)11-12-30-31(3,26)27)23-32(28,29)17-8-5-15(6-9-17)21-14(2)25/h5-10,13,23H,4,11-12H2,1-3H3,(H,21,25) |
| InChIKey | YIWFYEBEYVXMFF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 136.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|